C37H47O3P — CID 90958073
ethyl (2E,4E)-7-cyclohexyl-7-methoxy-4,6-dimethylhepta-2,4-dienoate;methylidene(triphenyl)-λ5-phosphane (PubChem CID 90958073) has the molecular formula C37H47O3P and a molecular weight of 570.75 g/mol. Its IUPAC name is ethyl (2E,4E)-7-cyclohexyl-7-methoxy-4,6-dimethylhepta-2,4-dienoate;methylidene(triphenyl)-λ5-phosphane.
| Compound Name | ethyl (2E,4E)-7-cyclohexyl-7-methoxy-4,6-dimethylhepta-2,4-dienoate;methylidene(triphenyl)-λ5-phosphane |
|---|---|
| PubChem CID | 90958073 |
| Molecular Formula | C37H47O3P |
| Molecular Weight | 570.75 g/mol |
| Exact Mass | 570.33 |
| IUPAC Name | ethyl (2E,4E)-7-cyclohexyl-7-methoxy-4,6-dimethylhepta-2,4-dienoate;methylidene(triphenyl)-λ5-phosphane |
| SMILES | C=P(c1ccccc1)(c1ccccc1)c1ccccc1.CCOC(=O)/C=C/C(C)=C/C(C)C(OC)C1CCCCC1 |
| InChI | InChI=1S/C19H17P.C18H30O3/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;1-5-21-17(19)12-11-14(2)13-15(3)18(20-4)16-9-7-6-8-10-16/h2-16H,1H2;11-13,15-16,18H,5-10H2,1-4H3/b;12-11+,14-13+ |
| InChIKey | NVQQSJGMWDJJRD-KFHRERJDSA-N |
| XLogP | 7.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.75 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|