C23H34O3 — CID 6636822
3-phenylpropyl (5R,6R)-6-cyclohexyl-6-methoxy-5-methylhex-3-enoate (PubChem CID 6636822) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is 3-phenylpropyl (5R,6R)-6-cyclohexyl-6-methoxy-5-methylhex-3-enoate.
| Compound Name | 3-phenylpropyl (5R,6R)-6-cyclohexyl-6-methoxy-5-methylhex-3-enoate |
|---|---|
| PubChem CID | 6636822 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 3-phenylpropyl (5R,6R)-6-cyclohexyl-6-methoxy-5-methylhex-3-enoate |
| SMILES | CO[C@H](C1CCCCC1)[C@H](C)C=CCC(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C23H34O3/c1-19(23(25-2)21-15-7-4-8-16-21)11-9-17-22(24)26-18-10-14-20-12-5-3-6-13-20/h3,5-6,9,11-13,19,21,23H,4,7-8,10,14-18H2,1-2H3/t19-,23+/m1/s1 |
| InChIKey | WFDPQRQYLWKFNQ-XXBNENTESA-N |
| XLogP | 5.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|