C25H37BrO4 — CID 16758923
methyl (E)-6-[(3-bromophenyl)methoxy]-8-cyclohexyl-8-methoxy-5,7-dimethyloct-3-enoate (PubChem CID 16758923) has the molecular formula C25H37BrO4 and a molecular weight of 481.47 g/mol. Its IUPAC name is methyl (E)-6-[(3-bromophenyl)methoxy]-8-cyclohexyl-8-methoxy-5,7-dimethyloct-3-enoate.
| Compound Name | methyl (E)-6-[(3-bromophenyl)methoxy]-8-cyclohexyl-8-methoxy-5,7-dimethyloct-3-enoate |
|---|---|
| PubChem CID | 16758923 |
| Molecular Formula | C25H37BrO4 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | methyl (E)-6-[(3-bromophenyl)methoxy]-8-cyclohexyl-8-methoxy-5,7-dimethyloct-3-enoate |
| SMILES | COC(=O)C/C=C/C(C)C(OCc1cccc(Br)c1)C(C)C(OC)C1CCCCC1 |
| InChI | InChI=1S/C25H37BrO4/c1-18(10-8-15-23(27)28-3)24(30-17-20-11-9-14-22(26)16-20)19(2)25(29-4)21-12-6-5-7-13-21/h8-11,14,16,18-19,21,24-25H,5-7,12-13,15,17H2,1-4H3/b10-8+ |
| InChIKey | WLQAURNMRHIGBI-CSKARUKUSA-N |
| XLogP | 6.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|