C23H17ClN3O+ — CID 85050785
2-[(2-chloro-1-phenylquinolin-4-ylidene)methyl]-4-methyl-[1,3]oxazolo[4,5-b]pyridin-4-ium (PubChem CID 85050785) has the molecular formula C23H17ClN3O+ and a molecular weight of 386.86 g/mol. Its IUPAC name is 2-[(2-chloro-1-phenylquinolin-4-ylidene)methyl]-4-methyl-[1,3]oxazolo[4,5-b]pyridin-4-ium.
| Compound Name | 2-[(2-chloro-1-phenylquinolin-4-ylidene)methyl]-4-methyl-[1,3]oxazolo[4,5-b]pyridin-4-ium |
|---|---|
| PubChem CID | 85050785 |
| Molecular Formula | C23H17ClN3O+ |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 2-[(2-chloro-1-phenylquinolin-4-ylidene)methyl]-4-methyl-[1,3]oxazolo[4,5-b]pyridin-4-ium |
| SMILES | C[n+]1cccc2oc(C=C3C=C(Cl)N(c4ccccc4)c4ccccc43)nc21 |
| InChI | InChI=1S/C23H17ClN3O/c1-26-13-7-12-20-23(26)25-22(28-20)15-16-14-21(24)27(17-8-3-2-4-9-17)19-11-6-5-10-18(16)19/h2-15H,1H3/q+1 |
| InChIKey | PSBVSUMZSHBOQB-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 33.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|