C23H24N3O4S+ — CID 20608369
4-[(4E)-4-[(E)-3-(4-methyl-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-yl)prop-2-enylidene]quinolin-1-yl]butane-1-sulfonic acid (PubChem CID 20608369) has the molecular formula C23H24N3O4S+ and a molecular weight of 438.53 g/mol. Its IUPAC name is 4-[(4E)-4-[(E)-3-(4-methyl-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-yl)prop-2-enylidene]quinolin-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[(4E)-4-[(E)-3-(4-methyl-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-yl)prop-2-enylidene]quinolin-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 20608369 |
| Molecular Formula | C23H24N3O4S+ |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 4-[(4E)-4-[(E)-3-(4-methyl-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-yl)prop-2-enylidene]quinolin-1-yl]butane-1-sulfonic acid |
| SMILES | C[n+]1cccc2oc(/C=C/C=C3\C=CN(CCCCS(=O)(=O)O)c4ccccc43)nc21 |
| InChI | InChI=1S/C23H23N3O4S/c1-25-14-7-11-21-23(25)24-22(30-21)12-6-8-18-13-16-26(15-4-5-17-31(27,28)29)20-10-3-2-9-19(18)20/h2-3,6-14,16H,4-5,15,17H2,1H3/p+1 |
| InChIKey | CTWUMFYHIVWAJQ-UHFFFAOYSA-O |
| XLogP | 3.75 |
| TPSA | 87.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|