C25H28N3O6S2+ — CID 74066560
6-[2-[3-[4-(3-sulfopropyl)-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]hexanoic acid (PubChem CID 74066560) has the molecular formula C25H28N3O6S2+ and a molecular weight of 530.65 g/mol. Its IUPAC name is 6-[2-[3-[4-(3-sulfopropyl)-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]hexanoic acid.
| Compound Name | 6-[2-[3-[4-(3-sulfopropyl)-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 74066560 |
| Molecular Formula | C25H28N3O6S2+ |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 6-[2-[3-[4-(3-sulfopropyl)-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-yl]prop-2-enylidene]-1,3-benzothiazol-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=CC=Cc2nc3c(ccc[n+]3CCCS(=O)(=O)O)o2)Sc2ccccc21 |
| InChI | InChI=1S/C25H27N3O6S2/c29-24(30)14-2-1-5-17-28-19-9-3-4-11-21(19)35-23(28)13-6-12-22-26-25-20(34-22)10-7-15-27(25)16-8-18-36(31,32)33/h3-4,6-7,9-13,15H,1-2,5,8,14,16-18H2,(H-,29,30,31,32,33)/p+1 |
| InChIKey | JMTRHVOTVIJIQV-UHFFFAOYSA-O |
| XLogP | 4.51 |
| TPSA | 124.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|