C30H36N3O8S3+ — CID 58680309
6-[3,3-dimethyl-2-[(1E,3E,5Z)-5-[5-sulfo-3-(3-sulfopropyl)-1,3-benzothiazol-2-ylidene]penta-1,3-dienyl]pyrrolo[2,3-b]pyridin-7-ium-7-yl]hexanoic acid (PubChem CID 58680309) has the molecular formula C30H36N3O8S3+ and a molecular weight of 662.83 g/mol. Its IUPAC name is 6-[3,3-dimethyl-2-[(1E,3E,5Z)-5-[5-sulfo-3-(3-sulfopropyl)-1,3-benzothiazol-2-ylidene]penta-1,3-dienyl]pyrrolo[2,3-b]pyridin-7-ium-7-yl]hexanoic acid.
| Compound Name | 6-[3,3-dimethyl-2-[(1E,3E,5Z)-5-[5-sulfo-3-(3-sulfopropyl)-1,3-benzothiazol-2-ylidene]penta-1,3-dienyl]pyrrolo[2,3-b]pyridin-7-ium-7-yl]hexanoic acid |
|---|---|
| PubChem CID | 58680309 |
| Molecular Formula | C30H36N3O8S3+ |
| Molecular Weight | 662.83 g/mol |
| Exact Mass | 662.17 |
| IUPAC Name | 6-[3,3-dimethyl-2-[(1E,3E,5Z)-5-[5-sulfo-3-(3-sulfopropyl)-1,3-benzothiazol-2-ylidene]penta-1,3-dienyl]pyrrolo[2,3-b]pyridin-7-ium-7-yl]hexanoic acid |
| SMILES | CC1(C)C(/C=C/C=C/C=C2\Sc3ccc(S(=O)(=O)O)cc3N2CCCS(=O)(=O)O)=Nc2c1ccc[n+]2CCCCCC(=O)O |
| InChI | InChI=1S/C30H35N3O8S3/c1-30(2)23-11-9-18-32(17-8-4-7-14-28(34)35)29(23)31-26(30)12-5-3-6-13-27-33(19-10-20-43(36,37)38)24-21-22(44(39,40)41)15-16-25(24)42-27/h3,5-6,9,11-13,15-16,18,21H,4,7-8,10,14,17,19-20H2,1-2H3,(H2-,34,35,36,37,38,39,40,41)/p+1 |
| InChIKey | DCGVTFDKDNKMSV-UHFFFAOYSA-O |
| XLogP | 5.07 |
| TPSA | 165.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.83 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|