C24H30N2O4S3 — CID 10143112
4-[(4Z)-4-[(4E)-4-(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)butylidene]quinolin-1-yl]butane-1-sulfonic acid (PubChem CID 10143112) has the molecular formula C24H30N2O4S3 and a molecular weight of 506.72 g/mol. Its IUPAC name is 4-[(4Z)-4-[(4E)-4-(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)butylidene]quinolin-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[(4Z)-4-[(4E)-4-(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)butylidene]quinolin-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 10143112 |
| Molecular Formula | C24H30N2O4S3 |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 4-[(4Z)-4-[(4E)-4-(3-butyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)butylidene]quinolin-1-yl]butane-1-sulfonic acid |
| SMILES | CCCCN1C(=O)/C(=C\CC/C=C2/C=CN(CCCCS(=O)(=O)O)c3ccccc32)SC1=S |
| InChI | InChI=1S/C24H30N2O4S3/c1-2-3-16-26-23(27)22(32-24(26)31)13-7-4-10-19-14-17-25(15-8-9-18-33(28,29)30)21-12-6-5-11-20(19)21/h5-6,10-14,17H,2-4,7-9,15-16,18H2,1H3,(H,28,29,30)/b19-10-,22-13+ |
| InChIKey | WCCKTNQHZSJJTI-BQWVOYBUSA-N |
| XLogP | 5.40 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|