C9H17BrO3 — CID 85058961
2-bromo-1,3,3-triethoxyprop-1-ene (PubChem CID 85058961) has the molecular formula C9H17BrO3 and a molecular weight of 253.14 g/mol. Its IUPAC name is 2-bromo-1,3,3-triethoxyprop-1-ene.
| Compound Name | 2-bromo-1,3,3-triethoxyprop-1-ene |
|---|---|
| PubChem CID | 85058961 |
| Molecular Formula | C9H17BrO3 |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 2-bromo-1,3,3-triethoxyprop-1-ene |
| SMILES | CCOC=C(Br)C(OCC)OCC |
| InChI | InChI=1S/C9H17BrO3/c1-4-11-7-8(10)9(12-5-2)13-6-3/h7,9H,4-6H2,1-3H3 |
| InChIKey | AGIFNGKWNDHVOQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|