C6H11BrO3 — CID 54102579
2-bromo-1,3,3-trimethoxyprop-1-ene (PubChem CID 54102579) has the molecular formula C6H11BrO3 and a molecular weight of 211.05 g/mol. Its IUPAC name is 2-bromo-1,3,3-trimethoxyprop-1-ene.
| Compound Name | 2-bromo-1,3,3-trimethoxyprop-1-ene |
|---|---|
| PubChem CID | 54102579 |
| Molecular Formula | C6H11BrO3 |
| Molecular Weight | 211.05 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | 2-bromo-1,3,3-trimethoxyprop-1-ene |
| SMILES | COC=C(Br)C(OC)OC |
| InChI | InChI=1S/C6H11BrO3/c1-8-4-5(7)6(9-2)10-3/h4,6H,1-3H3 |
| InChIKey | NBNSLJSUDVOWFI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.05 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|