C6H8Br2O2 — CID 15399304
1,3-dibromo-4,4-dimethoxybuta-1,2-diene (PubChem CID 15399304) has the molecular formula C6H8Br2O2 and a molecular weight of 271.94 g/mol. Its IUPAC name is 1,3-dibromo-4,4-dimethoxybuta-1,2-diene.
| Compound Name | 1,3-dibromo-4,4-dimethoxybuta-1,2-diene |
|---|---|
| PubChem CID | 15399304 |
| Molecular Formula | C6H8Br2O2 |
| Molecular Weight | 271.94 g/mol |
| Exact Mass | 269.89 |
| IUPAC Name | 1,3-dibromo-4,4-dimethoxybuta-1,2-diene |
| SMILES | COC(OC)C(Br)=C=CBr |
| InChI | InChI=1S/C6H8Br2O2/c1-9-6(10-2)5(8)3-4-7/h4,6H,1-2H3 |
| InChIKey | JDMVXZHSWWNKCS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.94 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|