C16H20N2O3S2 — CID 8506275
[2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-(thiophen-2-ylmethylsulfanyl)acetate (PubChem CID 8506275) has the molecular formula C16H20N2O3S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-(thiophen-2-ylmethylsulfanyl)acetate.
| Compound Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-(thiophen-2-ylmethylsulfanyl)acetate |
|---|---|
| PubChem CID | 8506275 |
| Molecular Formula | C16H20N2O3S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | [2-[(1-cyanocyclohexyl)amino]-2-oxoethyl] 2-(thiophen-2-ylmethylsulfanyl)acetate |
| SMILES | N#CC1(NC(=O)COC(=O)CSCc2cccs2)CCCCC1 |
| InChI | InChI=1S/C16H20N2O3S2/c17-12-16(6-2-1-3-7-16)18-14(19)9-21-15(20)11-22-10-13-5-4-8-23-13/h4-5,8H,1-3,6-7,9-11H2,(H,18,19) |
| InChIKey | QBAOBTSEDZBLQM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |