C20H16FN3O4S — CID 85074751
1-cyclopropyl-6-fluoro-7-(4-hydroxyimino-6,7-dihydro-5H-1-benzothiophen-2-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 85074751) has the molecular formula C20H16FN3O4S and a molecular weight of 413.43 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-7-(4-hydroxyimino-6,7-dihydro-5H-1-benzothiophen-2-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-7-(4-hydroxyimino-6,7-dihydro-5H-1-benzothiophen-2-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 85074751 |
| Molecular Formula | C20H16FN3O4S |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-7-(4-hydroxyimino-6,7-dihydro-5H-1-benzothiophen-2-yl)-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2nc(-c3cc4c(s3)CCCC4=NO)c(F)cc2c1=O |
| InChI | InChI=1S/C20H16FN3O4S/c21-13-6-11-18(25)12(20(26)27)8-24(9-4-5-9)19(11)22-17(13)16-7-10-14(23-28)2-1-3-15(10)29-16/h6-9,28H,1-5H2,(H,26,27) |
| InChIKey | QIMZEFWFHORPDT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|