C23H23N3O2 — CID 85090321
10-methyl-3-(4-methylphenyl)-2-(2-methylpropyl)pyrimido[4,5-b]quinoline-4,5-dione (PubChem CID 85090321) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 10-methyl-3-(4-methylphenyl)-2-(2-methylpropyl)pyrimido[4,5-b]quinoline-4,5-dione.
| Compound Name | 10-methyl-3-(4-methylphenyl)-2-(2-methylpropyl)pyrimido[4,5-b]quinoline-4,5-dione |
|---|---|
| PubChem CID | 85090321 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 10-methyl-3-(4-methylphenyl)-2-(2-methylpropyl)pyrimido[4,5-b]quinoline-4,5-dione |
| SMILES | Cc1ccc(-n2c(CC(C)C)nc3c(c(=O)c4ccccc4n3C)c2=O)cc1 |
| InChI | InChI=1S/C23H23N3O2/c1-14(2)13-19-24-22-20(21(27)17-7-5-6-8-18(17)25(22)4)23(28)26(19)16-11-9-15(3)10-12-16/h5-12,14H,13H2,1-4H3 |
| InChIKey | FRTXYGKAPYWUDO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|