C19H19FN2O4S — CID 8509907
[2-oxo-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethyl] 2-(4-fluorophenyl)acetate (PubChem CID 8509907) has the molecular formula C19H19FN2O4S and a molecular weight of 390.44 g/mol. Its IUPAC name is [2-oxo-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethyl] 2-(4-fluorophenyl)acetate.
| Compound Name | [2-oxo-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethyl] 2-(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 8509907 |
| Molecular Formula | C19H19FN2O4S |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [2-oxo-2-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethyl] 2-(4-fluorophenyl)acetate |
| SMILES | O=C(Cc1ccc(F)cc1)OCC(=O)N1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C19H19FN2O4S/c20-15-5-3-14(4-6-15)12-18(24)26-13-17(23)21-7-9-22(10-8-21)19(25)16-2-1-11-27-16/h1-6,11H,7-10,12-13H2 |
| InChIKey | JCMAMZXHJNEDQE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |