C15H15N5O3 — CID 8509935
[2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-3-phenyl-2-(tetrazol-1-yl)propanoate (PubChem CID 8509935) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-3-phenyl-2-(tetrazol-1-yl)propanoate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-3-phenyl-2-(tetrazol-1-yl)propanoate |
|---|---|
| PubChem CID | 8509935 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] (2S)-3-phenyl-2-(tetrazol-1-yl)propanoate |
| SMILES | C#CCNC(=O)COC(=O)[C@H](Cc1ccccc1)n1cnnn1 |
| InChI | InChI=1S/C15H15N5O3/c1-2-8-16-14(21)10-23-15(22)13(20-11-17-18-19-20)9-12-6-4-3-5-7-12/h1,3-7,11,13H,8-10H2,(H,16,21)/t13-/m0/s1 |
| InChIKey | YYMLAKAPILSRHN-ZDUSSCGKSA-N |
| XLogP | -0.25 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|