C16H16N2O3 — CID 85100766
prop-2-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate (PubChem CID 85100766) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is prop-2-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate.
| Compound Name | prop-2-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 85100766 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | prop-2-enyl 2-diazo-3-(1-oxo-3,4-dihydro-2H-naphthalen-2-yl)propanoate |
| SMILES | C=CCOC(=O)C(CC1CCc2ccccc2C1=O)=[N+]=[N-] |
| InChI | InChI=1S/C16H16N2O3/c1-2-9-21-16(20)14(18-17)10-12-8-7-11-5-3-4-6-13(11)15(12)19/h2-6,12H,1,7-10H2 |
| InChIKey | FEKRSZUECRSKEN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|