C20H28N2O5 — CID 85108995
7-hydroxy-17,24-dioxa-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosane-12,14-dione (PubChem CID 85108995) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is 7-hydroxy-17,24-dioxa-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosane-12,14-dione.
| Compound Name | 7-hydroxy-17,24-dioxa-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosane-12,14-dione |
|---|---|
| PubChem CID | 85108995 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 7-hydroxy-17,24-dioxa-3,13-diazahexacyclo[14.8.0.02,10.04,9.011,15.018,23]tetracosane-12,14-dione |
| SMILES | O=C1NC(=O)C2C1C1OC3CCCCC3OC1C1NC3CCC(O)CC3C12 |
| InChI | InChI=1S/C20H28N2O5/c23-8-5-6-10-9(7-8)13-14-15(20(25)22-19(14)24)17-18(16(13)21-10)27-12-4-2-1-3-11(12)26-17/h8-18,21,23H,1-7H2,(H,22,24,25) |
| InChIKey | MPVZCGGKRVKXDY-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|