C14H14N2O4 — CID 98550735
(1R,2R,3R,7R,8S,9R,10R,14R)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadecane-4,6,11,13-tetrone (PubChem CID 98550735) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is (1R,2R,3R,7R,8S,9R,10R,14R)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadecane-4,6,11,13-tetrone.
| Compound Name | (1R,2R,3R,7R,8S,9R,10R,14R)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadecane-4,6,11,13-tetrone |
|---|---|
| PubChem CID | 98550735 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (1R,2R,3R,7R,8S,9R,10R,14R)-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadecane-4,6,11,13-tetrone |
| SMILES | O=C1NC(=O)[C@@H]2[C@@H]3CC[C@@H]([C@@H]12)[C@@H]1[C@H]2C(=O)NC(=O)[C@@H]2[C@H]31 |
| InChI | InChI=1S/C14H14N2O4/c17-11-7-3-1-2-4(8(7)12(18)15-11)6-5(3)9-10(6)14(20)16-13(9)19/h3-10H,1-2H2,(H,15,17,18)(H,16,19,20)/t3-,4-,5-,6+,7-,8-,9-,10-/m1/s1 |
| InChIKey | ZHARRQVQVVYNTD-GKYTZBSQSA-N |
| XLogP | -0.95 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|