C9H10N2O2 — CID 15150627
(1S,2R,7S,8R)-3,5-diazatricyclo[6.2.1.02,7]undec-9-ene-4,6-dione (PubChem CID 15150627) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is (1S,2R,7S,8R)-3,5-diazatricyclo[6.2.1.02,7]undec-9-ene-4,6-dione.
| Compound Name | (1S,2R,7S,8R)-3,5-diazatricyclo[6.2.1.02,7]undec-9-ene-4,6-dione |
|---|---|
| PubChem CID | 15150627 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | (1S,2R,7S,8R)-3,5-diazatricyclo[6.2.1.02,7]undec-9-ene-4,6-dione |
| SMILES | O=C1NC(=O)[C@@H]2[C@H](N1)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C9H10N2O2/c12-8-6-4-1-2-5(3-4)7(6)10-9(13)11-8/h1-2,4-7H,3H2,(H2,10,11,12,13)/t4-,5+,6-,7+/m0/s1 |
| InChIKey | VFTHLBXCQBKWFM-BNHYGAARSA-N |
| XLogP | 0.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|