C17H15NO5 — CID 8511107
[2-oxo-2-(prop-2-ynylamino)ethyl] 5-(phenoxymethyl)furan-2-carboxylate (PubChem CID 8511107) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-ynylamino)ethyl] 5-(phenoxymethyl)furan-2-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 5-(phenoxymethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 8511107 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | [2-oxo-2-(prop-2-ynylamino)ethyl] 5-(phenoxymethyl)furan-2-carboxylate |
| SMILES | C#CCNC(=O)COC(=O)c1ccc(COc2ccccc2)o1 |
| InChI | InChI=1S/C17H15NO5/c1-2-10-18-16(19)12-22-17(20)15-9-8-14(23-15)11-21-13-6-4-3-5-7-13/h1,3-9H,10-12H2,(H,18,19) |
| InChIKey | RWBPPNBCAZXGNC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|