C20H16ClNO5 — CID 7468770
[2-(2-chloroanilino)-2-oxoethyl] 5-(phenoxymethyl)furan-2-carboxylate (PubChem CID 7468770) has the molecular formula C20H16ClNO5 and a molecular weight of 385.80 g/mol. Its IUPAC name is [2-(2-chloroanilino)-2-oxoethyl] 5-(phenoxymethyl)furan-2-carboxylate.
| Compound Name | [2-(2-chloroanilino)-2-oxoethyl] 5-(phenoxymethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 7468770 |
| Molecular Formula | C20H16ClNO5 |
| Molecular Weight | 385.80 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | [2-(2-chloroanilino)-2-oxoethyl] 5-(phenoxymethyl)furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(COc2ccccc2)o1)Nc1ccccc1Cl |
| InChI | InChI=1S/C20H16ClNO5/c21-16-8-4-5-9-17(16)22-19(23)13-26-20(24)18-11-10-15(27-18)12-25-14-6-2-1-3-7-14/h1-11H,12-13H2,(H,22,23) |
| InChIKey | IRQSSFPXZMXPAT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.80 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |