C19H14ClFN2O5 — CID 31958862
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 5-[(4-fluorophenoxy)methyl]furan-2-carboxylate (PubChem CID 31958862) has the molecular formula C19H14ClFN2O5 and a molecular weight of 404.78 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 5-[(4-fluorophenoxy)methyl]furan-2-carboxylate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 5-[(4-fluorophenoxy)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 31958862 |
| Molecular Formula | C19H14ClFN2O5 |
| Molecular Weight | 404.78 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 5-[(4-fluorophenoxy)methyl]furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(COc2ccc(F)cc2)o1)Nc1cccnc1Cl |
| InChI | InChI=1S/C19H14ClFN2O5/c20-18-15(2-1-9-22-18)23-17(24)11-27-19(25)16-8-7-14(28-16)10-26-13-5-3-12(21)4-6-13/h1-9H,10-11H2,(H,23,24) |
| InChIKey | UVQRTPOJBRENRW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.78 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|