C19H14FNO7 — CID 24557683
[2-(furan-2-carbonylamino)-2-oxoethyl] 5-[(4-fluorophenoxy)methyl]furan-2-carboxylate (PubChem CID 24557683) has the molecular formula C19H14FNO7 and a molecular weight of 387.32 g/mol. Its IUPAC name is [2-(furan-2-carbonylamino)-2-oxoethyl] 5-[(4-fluorophenoxy)methyl]furan-2-carboxylate.
| Compound Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 5-[(4-fluorophenoxy)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 24557683 |
| Molecular Formula | C19H14FNO7 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 5-[(4-fluorophenoxy)methyl]furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(COc2ccc(F)cc2)o1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C19H14FNO7/c20-12-3-5-13(6-4-12)26-10-14-7-8-16(28-14)19(24)27-11-17(22)21-18(23)15-2-1-9-25-15/h1-9H,10-11H2,(H,21,22,23) |
| InChIKey | PZWZELRKBYDUHR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 107.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |