C18H19ClN2O5S — CID 8511643
[2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate (PubChem CID 8511643) has the molecular formula C18H19ClN2O5S and a molecular weight of 410.88 g/mol. Its IUPAC name is [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate.
| Compound Name | [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 8511643 |
| Molecular Formula | C18H19ClN2O5S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | [2-[4-[methyl(methylsulfonyl)amino]phenyl]-2-oxoethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate |
| SMILES | Cc1cc(C)c(C(=O)OCC(=O)c2ccc(N(C)S(C)(=O)=O)cc2)c(Cl)n1 |
| InChI | InChI=1S/C18H19ClN2O5S/c1-11-9-12(2)20-17(19)16(11)18(23)26-10-15(22)13-5-7-14(8-6-13)21(3)27(4,24)25/h5-9H,10H2,1-4H3 |
| InChIKey | PSXUWRDUTKIFLH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|