C15H17N3OS — CID 851323
3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-phenylpropanamide (PubChem CID 851323) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-phenylpropanamide.
| Compound Name | 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-phenylpropanamide |
|---|---|
| PubChem CID | 851323 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-(4,6-dimethylpyrimidin-2-yl)sulfanyl-N-phenylpropanamide |
| SMILES | Cc1cc(C)nc(SCCC(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C15H17N3OS/c1-11-10-12(2)17-15(16-11)20-9-8-14(19)18-13-6-4-3-5-7-13/h3-7,10H,8-9H2,1-2H3,(H,18,19) |
| InChIKey | LHXZJQNQFRVCTB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |