C19H24ClN2O3+ — CID 8514580
[(2R)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl]-methyl-(2-phenoxyethyl)azanium (PubChem CID 8514580) has the molecular formula C19H24ClN2O3+ and a molecular weight of 363.87 g/mol. Its IUPAC name is [(2R)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl]-methyl-(2-phenoxyethyl)azanium.
| Compound Name | [(2R)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl]-methyl-(2-phenoxyethyl)azanium |
|---|---|
| PubChem CID | 8514580 |
| Molecular Formula | C19H24ClN2O3+ |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | [(2R)-1-(5-chloro-2-methoxyanilino)-1-oxopropan-2-yl]-methyl-(2-phenoxyethyl)azanium |
| SMILES | COc1ccc(Cl)cc1NC(=O)[C@@H](C)[NH+](C)CCOc1ccccc1 |
| InChI | InChI=1S/C19H23ClN2O3/c1-14(22(2)11-12-25-16-7-5-4-6-8-16)19(23)21-17-13-15(20)9-10-18(17)24-3/h4-10,13-14H,11-12H2,1-3H3,(H,21,23)/p+1/t14-/m1/s1 |
| InChIKey | CNXKZSDFEVXSOE-CQSZACIVSA-O |
| XLogP | 2.27 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |