C7H14O3 — CID 85156998
1,1,4-trimethoxybut-2-ene (PubChem CID 85156998) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is 1,1,4-trimethoxybut-2-ene.
| Compound Name | 1,1,4-trimethoxybut-2-ene |
|---|---|
| PubChem CID | 85156998 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 1,1,4-trimethoxybut-2-ene |
| SMILES | COCC=CC(OC)OC |
| InChI | InChI=1S/C7H14O3/c1-8-6-4-5-7(9-2)10-3/h4-5,7H,6H2,1-3H3 |
| InChIKey | QISPMSVTAGXUMU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|