C17H20N4OS — CID 851620
2-(4-methylpyrimidin-2-yl)sulfanyl-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 851620) has the molecular formula C17H20N4OS and a molecular weight of 328.44 g/mol. Its IUPAC name is 2-(4-methylpyrimidin-2-yl)sulfanyl-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-(4-methylpyrimidin-2-yl)sulfanyl-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 851620 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-(4-methylpyrimidin-2-yl)sulfanyl-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | Cc1ccnc(SCC(=O)N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C17H20N4OS/c1-14-7-8-18-17(19-14)23-13-16(22)21-11-9-20(10-12-21)15-5-3-2-4-6-15/h2-8H,9-13H2,1H3 |
| InChIKey | ZVELGKPYLDKGEC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |