C13H13BrO2 — CID 85168471
3-bromo-4-methoxy-1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene (PubChem CID 85168471) has the molecular formula C13H13BrO2 and a molecular weight of 281.15 g/mol. Its IUPAC name is 3-bromo-4-methoxy-1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene.
| Compound Name | 3-bromo-4-methoxy-1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
|---|---|
| PubChem CID | 85168471 |
| Molecular Formula | C13H13BrO2 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 3-bromo-4-methoxy-1,8-dimethyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
| SMILES | COc1ccc2c(c1Br)C1(C)C=CC2(C)O1 |
| InChI | InChI=1S/C13H13BrO2/c1-12-6-7-13(2,16-12)10-8(12)4-5-9(15-3)11(10)14/h4-7H,1-3H3 |
| InChIKey | IVDROPADJNYYPO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|