C17H26N2O4 — CID 85179154
diethyl 8a-cyano-3-methyl-1,2,3,4,4a,6,7,8-octahydroisoquinoline-5,5-dicarboxylate (PubChem CID 85179154) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is diethyl 8a-cyano-3-methyl-1,2,3,4,4a,6,7,8-octahydroisoquinoline-5,5-dicarboxylate.
| Compound Name | diethyl 8a-cyano-3-methyl-1,2,3,4,4a,6,7,8-octahydroisoquinoline-5,5-dicarboxylate |
|---|---|
| PubChem CID | 85179154 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | diethyl 8a-cyano-3-methyl-1,2,3,4,4a,6,7,8-octahydroisoquinoline-5,5-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCCC2(C#N)CNC(C)CC21 |
| InChI | InChI=1S/C17H26N2O4/c1-4-22-14(20)17(15(21)23-5-2)8-6-7-16(10-18)11-19-12(3)9-13(16)17/h12-13,19H,4-9,11H2,1-3H3 |
| InChIKey | SEDCZBDBWNFMEF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|