C40H56O7 — CID 85184158
methyl 3-(4-hydroxy-2-methoxy-4-methyloxolan-2-yl)-2-(3-hydroxy-2,6,14-trimethyl-9-phenyl-8-oxahexacyclo[16.3.1.01,18.02,15.05,14.06,11]docos-11-en-19-yl)propanoate (PubChem CID 85184158) has the molecular formula C40H56O7 and a molecular weight of 648.88 g/mol. Its IUPAC name is methyl 3-(4-hydroxy-2-methoxy-4-methyloxolan-2-yl)-2-(3-hydroxy-2,6,14-trimethyl-9-phenyl-8-oxahexacyclo[16.3.1.01,18.02,15.05,14.06,11]docos-11-en-19-yl)propanoate.
| Compound Name | methyl 3-(4-hydroxy-2-methoxy-4-methyloxolan-2-yl)-2-(3-hydroxy-2,6,14-trimethyl-9-phenyl-8-oxahexacyclo[16.3.1.01,18.02,15.05,14.06,11]docos-11-en-19-yl)propanoate |
|---|---|
| PubChem CID | 85184158 |
| Molecular Formula | C40H56O7 |
| Molecular Weight | 648.88 g/mol |
| Exact Mass | 648.40 |
| IUPAC Name | methyl 3-(4-hydroxy-2-methoxy-4-methyloxolan-2-yl)-2-(3-hydroxy-2,6,14-trimethyl-9-phenyl-8-oxahexacyclo[16.3.1.01,18.02,15.05,14.06,11]docos-11-en-19-yl)propanoate |
| SMILES | COC(=O)C(CC1(OC)CC(C)(O)CO1)C1CCC23CC12CCC1C2(C)CC=C4CC(c5ccccc5)OCC4(C)C2CC(O)C13C |
| InChI | InChI=1S/C40H56O7/c1-34(43)21-40(45-6,47-23-34)20-27(33(42)44-5)28-13-17-39-22-38(28,39)16-14-30-35(2)15-12-26-18-29(25-10-8-7-9-11-25)46-24-36(26,3)31(35)19-32(41)37(30,39)4/h7-12,27-32,41,43H,13-24H2,1-6H3 |
| InChIKey | SPVHFBQEUCWXSL-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.88 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|