C9H17N3O6S — CID 85214812
4-[(2-aminopropanoylamino)methylamino]-2-methylsulfonyl-4-oxobutanoic acid (PubChem CID 85214812) has the molecular formula C9H17N3O6S and a molecular weight of 295.32 g/mol. Its IUPAC name is 4-[(2-aminopropanoylamino)methylamino]-2-methylsulfonyl-4-oxobutanoic acid.
| Compound Name | 4-[(2-aminopropanoylamino)methylamino]-2-methylsulfonyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 85214812 |
| Molecular Formula | C9H17N3O6S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 4-[(2-aminopropanoylamino)methylamino]-2-methylsulfonyl-4-oxobutanoic acid |
| SMILES | CC(N)C(=O)NCNC(=O)CC(C(=O)O)S(C)(=O)=O |
| InChI | InChI=1S/C9H17N3O6S/c1-5(10)8(14)12-4-11-7(13)3-6(9(15)16)19(2,17)18/h5-6H,3-4,10H2,1-2H3,(H,11,13)(H,12,14)(H,15,16) |
| InChIKey | QPOFRFGIYSXYSK-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|