C10H15N3O6S — CID 87927463
4-[[1-(cyanomethylamino)-3-methylsulfonyl-1-oxopropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 87927463) has the molecular formula C10H15N3O6S and a molecular weight of 305.31 g/mol. Its IUPAC name is 4-[[1-(cyanomethylamino)-3-methylsulfonyl-1-oxopropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[1-(cyanomethylamino)-3-methylsulfonyl-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87927463 |
| Molecular Formula | C10H15N3O6S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 4-[[1-(cyanomethylamino)-3-methylsulfonyl-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CS(=O)(=O)CC(NC(=O)CCC(=O)O)C(=O)NCC#N |
| InChI | InChI=1S/C10H15N3O6S/c1-20(18,19)6-7(10(17)12-5-4-11)13-8(14)2-3-9(15)16/h7H,2-3,5-6H2,1H3,(H,12,17)(H,13,14)(H,15,16) |
| InChIKey | NPUZYCLFJNZOLR-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 153.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|