C20H10Cl6O2 — CID 85236066
1,3,4,6-tetrachloro-7,7-bis(4-chlorophenyl)bicyclo[4.2.0]oct-3-ene-2,5-dione (PubChem CID 85236066) has the molecular formula C20H10Cl6O2 and a molecular weight of 495.02 g/mol. Its IUPAC name is 1,3,4,6-tetrachloro-7,7-bis(4-chlorophenyl)bicyclo[4.2.0]oct-3-ene-2,5-dione.
| Compound Name | 1,3,4,6-tetrachloro-7,7-bis(4-chlorophenyl)bicyclo[4.2.0]oct-3-ene-2,5-dione |
|---|---|
| PubChem CID | 85236066 |
| Molecular Formula | C20H10Cl6O2 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 491.88 |
| IUPAC Name | 1,3,4,6-tetrachloro-7,7-bis(4-chlorophenyl)bicyclo[4.2.0]oct-3-ene-2,5-dione |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)C2(Cl)C1(Cl)CC2(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H10Cl6O2/c21-12-5-1-10(2-6-12)18(11-3-7-13(22)8-4-11)9-19(25)16(27)14(23)15(24)17(28)20(18,19)26/h1-8H,9H2 |
| InChIKey | NBCPMNJGKVFPKM-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|