C26H37NO5Si — CID 85244119
methyl 3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 85244119) has the molecular formula C26H37NO5Si and a molecular weight of 471.67 g/mol. Its IUPAC name is methyl 3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | methyl 3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 85244119 |
| Molecular Formula | C26H37NO5Si |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | methyl 3-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | COC(=O)C(NC(=O)OC(C)(C)C)C(C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H37NO5Si/c1-19(22(23(28)30-8)27-24(29)31-25(2,3)4)32-33(26(5,6)7,20-15-11-9-12-16-20)21-17-13-10-14-18-21/h9-19,22H,1-8H3,(H,27,29) |
| InChIKey | OMVHHRWXURARSK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|