C24H33NO5Si — CID 11026635
methyl 2-[4-[tert-butyl(diphenyl)silyl]oxybutanoylamino]-3-hydroxypropanoate (PubChem CID 11026635) has the molecular formula C24H33NO5Si and a molecular weight of 443.62 g/mol. Its IUPAC name is methyl 2-[4-[tert-butyl(diphenyl)silyl]oxybutanoylamino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[4-[tert-butyl(diphenyl)silyl]oxybutanoylamino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 11026635 |
| Molecular Formula | C24H33NO5Si |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | methyl 2-[4-[tert-butyl(diphenyl)silyl]oxybutanoylamino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NC(=O)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H33NO5Si/c1-24(2,3)31(19-12-7-5-8-13-19,20-14-9-6-10-15-20)30-17-11-16-22(27)25-21(18-26)23(28)29-4/h5-10,12-15,21,26H,11,16-18H2,1-4H3,(H,25,27) |
| InChIKey | HAWJXHSWMCBQDQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|