C10H16O2 — CID 85247154
4-hydroxy-5,6-dimethylbicyclo[2.2.2]octan-2-one (PubChem CID 85247154) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 4-hydroxy-5,6-dimethylbicyclo[2.2.2]octan-2-one.
| Compound Name | 4-hydroxy-5,6-dimethylbicyclo[2.2.2]octan-2-one |
|---|---|
| PubChem CID | 85247154 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 4-hydroxy-5,6-dimethylbicyclo[2.2.2]octan-2-one |
| SMILES | CC1C2CCC(O)(CC2=O)C1C |
| InChI | InChI=1S/C10H16O2/c1-6-7(2)10(12)4-3-8(6)9(11)5-10/h6-8,12H,3-5H2,1-2H3 |
| InChIKey | ACGLWJHCTXHRQO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |