C8H10O3 — CID 11665446
4-hydroxybicyclo[2.2.2]octane-2,6-dione (PubChem CID 11665446) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 4-hydroxybicyclo[2.2.2]octane-2,6-dione.
| Compound Name | 4-hydroxybicyclo[2.2.2]octane-2,6-dione |
|---|---|
| PubChem CID | 11665446 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 4-hydroxybicyclo[2.2.2]octane-2,6-dione |
| SMILES | O=C1CC2(O)CCC1C(=O)C2 |
| InChI | InChI=1S/C8H10O3/c9-6-3-8(11)2-1-5(6)7(10)4-8/h5,11H,1-4H2 |
| InChIKey | IOCCWFIVRDPFSZ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|