C10H14N2O2 — CID 85247290
3-(3-methylbut-2-enyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione (PubChem CID 85247290) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-(3-methylbut-2-enyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione.
| Compound Name | 3-(3-methylbut-2-enyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione |
|---|---|
| PubChem CID | 85247290 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3-(3-methylbut-2-enyl)-3,4-diazabicyclo[4.1.0]heptane-2,5-dione |
| SMILES | CC(C)=CCN1NC(=O)C2CC2C1=O |
| InChI | InChI=1S/C10H14N2O2/c1-6(2)3-4-12-10(14)8-5-7(8)9(13)11-12/h3,7-8H,4-5H2,1-2H3,(H,11,13) |
| InChIKey | RHUNXYAQAOIYCL-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|