C9H14N2O2 — CID 10773775
3-butyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione (PubChem CID 10773775) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-butyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione.
| Compound Name | 3-butyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione |
|---|---|
| PubChem CID | 10773775 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3-butyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione |
| SMILES | CCCCN1NC(=O)C2CC2C1=O |
| InChI | InChI=1S/C9H14N2O2/c1-2-3-4-11-9(13)7-5-6(7)8(12)10-11/h6-7H,2-5H2,1H3,(H,10,12) |
| InChIKey | JQPGBQCBWJHLKD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |