C28H44O2 — CID 85259762
14-(5,6-dimethylhept-3-en-2-yl)-2,15-dimethyl-18-oxatetracyclo[8.7.1.02,7.011,15]octadeca-1(17),9-dien-5-ol (PubChem CID 85259762) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is 14-(5,6-dimethylhept-3-en-2-yl)-2,15-dimethyl-18-oxatetracyclo[8.7.1.02,7.011,15]octadeca-1(17),9-dien-5-ol.
| Compound Name | 14-(5,6-dimethylhept-3-en-2-yl)-2,15-dimethyl-18-oxatetracyclo[8.7.1.02,7.011,15]octadeca-1(17),9-dien-5-ol |
|---|---|
| PubChem CID | 85259762 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | 14-(5,6-dimethylhept-3-en-2-yl)-2,15-dimethyl-18-oxatetracyclo[8.7.1.02,7.011,15]octadeca-1(17),9-dien-5-ol |
| SMILES | CC(C)C(C)C=CC(C)C1CCC2C3=CCC4CC(O)CCC4(C)C(=CCC21C)O3 |
| InChI | InChI=1S/C28H44O2/c1-18(2)19(3)7-8-20(4)23-10-11-24-25-12-9-21-17-22(29)13-15-27(21,5)26(30-25)14-16-28(23,24)6/h7-8,12,14,18-24,29H,9-11,13,15-17H2,1-6H3 |
| InChIKey | CINZVIXZRUAXFE-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|