C28H42O — CID 5363271
14-[(E)-5,6-dimethylhept-3-en-2-yl]-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadeca-1(17),9-dien-8-ol (PubChem CID 5363271) has the molecular formula C28H42O and a molecular weight of 394.64 g/mol. Its IUPAC name is 14-[(E)-5,6-dimethylhept-3-en-2-yl]-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadeca-1(17),9-dien-8-ol.
| Compound Name | 14-[(E)-5,6-dimethylhept-3-en-2-yl]-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadeca-1(17),9-dien-8-ol |
|---|---|
| PubChem CID | 5363271 |
| Molecular Formula | C28H42O |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.32 |
| IUPAC Name | 14-[(E)-5,6-dimethylhept-3-en-2-yl]-2,15-dimethylpentacyclo[8.7.0.02,7.05,7.011,15]heptadeca-1(17),9-dien-8-ol |
| SMILES | CC(C)C(C)/C=C/C(C)C1CCC2C3=CC(O)C45CC4CCC5(C)C3=CCC21C |
| InChI | InChI=1S/C28H42O/c1-17(2)18(3)7-8-19(4)22-9-10-23-21-15-25(29)28-16-20(28)11-14-27(28,6)24(21)12-13-26(22,23)5/h7-8,12,15,17-20,22-23,25,29H,9-11,13-14,16H2,1-6H3/b8-7+ |
| InChIKey | XGAVJWARXUCCJQ-BQYQJAHWSA-N |
| XLogP | 6.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|