C29H46O4 — CID 146682452
(3S,5R,6R,10R,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-6-methoxy-10,13-dimethyl-2,3,4,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,5,14-triol (PubChem CID 146682452) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is (3S,5R,6R,10R,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-6-methoxy-10,13-dimethyl-2,3,4,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,5,14-triol.
| Compound Name | (3S,5R,6R,10R,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-6-methoxy-10,13-dimethyl-2,3,4,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,5,14-triol |
|---|---|
| PubChem CID | 146682452 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | (3S,5R,6R,10R,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-6-methoxy-10,13-dimethyl-2,3,4,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,5,14-triol |
| SMILES | CO[C@@H]1C=C2C(=CC[C@]3(C)[C@@H]([C@H](C)/C=C/[C@H](C)C(C)C)CC[C@]23O)[C@@]2(C)CC[C@H](O)C[C@]12O |
| InChI | InChI=1S/C29H46O4/c1-18(2)19(3)8-9-20(4)22-12-15-28(31)24-16-25(33-7)29(32)17-21(30)10-13-27(29,6)23(24)11-14-26(22,28)5/h8-9,11,16,18-22,25,30-32H,10,12-15,17H2,1-7H3/b9-8+/t19-,20+,21-,22+,25+,26+,27+,28-,29-/m0/s1 |
| InChIKey | ZNQTVDWBXOHGDP-BMPWRIHXSA-N |
| XLogP | 5.19 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|