C13H12 — CID 85263707
2,3-bis(prop-1-ynyl)bicyclo[2.2.1]hepta-2,5-diene (PubChem CID 85263707) has the molecular formula C13H12 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2,3-bis(prop-1-ynyl)bicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | 2,3-bis(prop-1-ynyl)bicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 85263707 |
| Molecular Formula | C13H12 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 2,3-bis(prop-1-ynyl)bicyclo[2.2.1]hepta-2,5-diene |
| SMILES | CC#CC1=C(C#CC)C2C=CC1C2 |
| InChI | InChI=1S/C13H12/c1-3-5-12-10-7-8-11(9-10)13(12)6-4-2/h7-8,10-11H,9H2,1-2H3 |
| InChIKey | GKTPDKMXWXGYQL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|