C18H17ClN2OS2 — CID 8527823
7-chloro-3-(3-methylphenyl)-2-(2-methylsulfanylethylsulfanyl)quinazolin-4-one (PubChem CID 8527823) has the molecular formula C18H17ClN2OS2 and a molecular weight of 376.93 g/mol. Its IUPAC name is 7-chloro-3-(3-methylphenyl)-2-(2-methylsulfanylethylsulfanyl)quinazolin-4-one.
| Compound Name | 7-chloro-3-(3-methylphenyl)-2-(2-methylsulfanylethylsulfanyl)quinazolin-4-one |
|---|---|
| PubChem CID | 8527823 |
| Molecular Formula | C18H17ClN2OS2 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 7-chloro-3-(3-methylphenyl)-2-(2-methylsulfanylethylsulfanyl)quinazolin-4-one |
| SMILES | CSCCSc1nc2cc(Cl)ccc2c(=O)n1-c1cccc(C)c1 |
| InChI | InChI=1S/C18H17ClN2OS2/c1-12-4-3-5-14(10-12)21-17(22)15-7-6-13(19)11-16(15)20-18(21)24-9-8-23-2/h3-7,10-11H,8-9H2,1-2H3 |
| InChIKey | QKZOSJKSJLCVMN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|