C8H10O3 — CID 85299243
5-ethyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one (PubChem CID 85299243) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is 5-ethyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | 5-ethyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 85299243 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 5-ethyl-6,8-dioxabicyclo[3.2.1]oct-3-en-2-one |
| SMILES | CCC12C=CC(=O)C(CO1)O2 |
| InChI | InChI=1S/C8H10O3/c1-2-8-4-3-6(9)7(11-8)5-10-8/h3-4,7H,2,5H2,1H3 |
| InChIKey | MPNHXTPVYGIUPP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |