C20H24BrN3O2 — CID 8533654
2-[[2-[benzyl(ethyl)amino]acetyl]amino]-N-(4-bromo-2-methylphenyl)acetamide (PubChem CID 8533654) has the molecular formula C20H24BrN3O2 and a molecular weight of 418.34 g/mol. Its IUPAC name is 2-[[2-[benzyl(ethyl)amino]acetyl]amino]-N-(4-bromo-2-methylphenyl)acetamide.
| Compound Name | 2-[[2-[benzyl(ethyl)amino]acetyl]amino]-N-(4-bromo-2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 8533654 |
| Molecular Formula | C20H24BrN3O2 |
| Molecular Weight | 418.34 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2-[[2-[benzyl(ethyl)amino]acetyl]amino]-N-(4-bromo-2-methylphenyl)acetamide |
| SMILES | CCN(CC(=O)NCC(=O)Nc1ccc(Br)cc1C)Cc1ccccc1 |
| InChI | InChI=1S/C20H24BrN3O2/c1-3-24(13-16-7-5-4-6-8-16)14-20(26)22-12-19(25)23-18-10-9-17(21)11-15(18)2/h4-11H,3,12-14H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | SCZOVAMVJMISPP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |