About 6-diazotridecan-7-one
6-diazotridecan-7-one (PubChem CID 85353104) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is 6-diazotridecan-7-one.
Molecular Properties
| Compound Name | 6-diazotridecan-7-one |
| PubChem CID | 85353104 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 6-diazotridecan-7-one |
| SMILES | CCCCCCC(=O)C(CCCCC)=[N+]=[N-] |
| InChI | InChI=1S/C13H24N2O/c1-3-5-7-9-11-13(16)12(15-14)10-8-6-4-2/h3-11H2,1-2H3 |
| InChIKey | AYYPXRBOHLUIIS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-diazotridecan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-diazotridecan-7-one?
The IUPAC name of 6-diazotridecan-7-one (CID 85353104) is 6-diazotridecan-7-one.
What is the SMILES notation for 6-diazotridecan-7-one?
The canonical SMILES for 6-diazotridecan-7-one is CCCCCCC(=O)C(CCCCC)=[N+]=[N-].
What is the InChIKey of 6-diazotridecan-7-one?
The InChIKey is AYYPXRBOHLUIIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O/c1-3-5-7-9-11-13(16)12(15-14)10-8-6-4-2/h3-11H2,1-2H3.
What are the key properties of 6-diazotridecan-7-one?
6-diazotridecan-7-one has a molecular weight of 224.35 g/mol, XLogP of 3.78, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-diazotridecan-7-one is sourced from PubChem (CID 85353104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).