About 3-diazoheptan-2-one
3-diazoheptan-2-one (PubChem CID 101114656) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 3-diazoheptan-2-one.
Molecular Properties
| Compound Name | 3-diazoheptan-2-one |
| PubChem CID | 101114656 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 3-diazoheptan-2-one |
| SMILES | CCCCC(=[N+]=[N-])C(C)=O |
| InChI | InChI=1S/C7H12N2O/c1-3-4-5-7(9-8)6(2)10/h3-5H2,1-2H3 |
| InChIKey | YYMKLQNVVYEWFP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-diazoheptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diazoheptan-2-one?
The IUPAC name of 3-diazoheptan-2-one (CID 101114656) is 3-diazoheptan-2-one.
What is the SMILES notation for 3-diazoheptan-2-one?
The canonical SMILES for 3-diazoheptan-2-one is CCCCC(=[N+]=[N-])C(C)=O.
What is the InChIKey of 3-diazoheptan-2-one?
The InChIKey is YYMKLQNVVYEWFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-3-4-5-7(9-8)6(2)10/h3-5H2,1-2H3.
What are the key properties of 3-diazoheptan-2-one?
3-diazoheptan-2-one has a molecular weight of 140.19 g/mol, XLogP of 1.44, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diazoheptan-2-one is sourced from PubChem (CID 101114656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).